C17H18Cl2N2 — CID 65469717
1-benzyl-N-(2,6-dichlorophenyl)pyrrolidin-3-amine (PubChem CID 65469717) has the molecular formula C17H18Cl2N2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 1-benzyl-N-(2,6-dichlorophenyl)pyrrolidin-3-amine.
| Compound Name | 1-benzyl-N-(2,6-dichlorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 65469717 |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-benzyl-N-(2,6-dichlorophenyl)pyrrolidin-3-amine |
| SMILES | Clc1cccc(Cl)c1NC1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H18Cl2N2/c18-15-7-4-8-16(19)17(15)20-14-9-10-21(12-14)11-13-5-2-1-3-6-13/h1-8,14,20H,9-12H2 |
| InChIKey | SHSKFXYHDSMGDM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |