C16H25N3O3Si — CID 90987673
2-[5-ethynyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylic acid (PubChem CID 90987673) has the molecular formula C16H25N3O3Si and a molecular weight of 335.48 g/mol. Its IUPAC name is 2-[5-ethynyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-[5-ethynyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90987673 |
| Molecular Formula | C16H25N3O3Si |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-[5-ethynyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylic acid |
| SMILES | C#Cc1cnc(C2CCCN2C(=O)O)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H25N3O3Si/c1-5-13-11-17-15(14-7-6-8-18(14)16(20)21)19(13)12-22-9-10-23(2,3)4/h1,11,14H,6-10,12H2,2-4H3,(H,20,21) |
| InChIKey | YFGHXWDXXGYNBD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|