C20H33N3O3Si — CID 142790675
tert-butyl 2-[5-ethynyl-1-(1-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 142790675) has the molecular formula C20H33N3O3Si and a molecular weight of 391.59 g/mol. Its IUPAC name is tert-butyl 2-[5-ethynyl-1-(1-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[5-ethynyl-1-(1-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142790675 |
| Molecular Formula | C20H33N3O3Si |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | tert-butyl 2-[5-ethynyl-1-(1-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C#Cc1cnc(C2CCCN2C(=O)OC(C)(C)C)n1COC(C)[Si](C)(C)C |
| InChI | InChI=1S/C20H33N3O3Si/c1-9-16-13-21-18(23(16)14-25-15(2)27(6,7)8)17-11-10-12-22(17)19(24)26-20(3,4)5/h1,13,15,17H,10-12,14H2,2-8H3 |
| InChIKey | DQVFBBGDFFZPAZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|