C23H42N4O3Si — CID 59611340
tert-butyl (2S)-2-[5-piperidin-4-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 59611340) has the molecular formula C23H42N4O3Si and a molecular weight of 450.70 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-piperidin-4-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-piperidin-4-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59611340 |
| Molecular Formula | C23H42N4O3Si |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | tert-butyl (2S)-2-[5-piperidin-4-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1ncc(C2CCNCC2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C23H42N4O3Si/c1-23(2,3)30-22(28)26-13-7-8-19(26)21-25-16-20(18-9-11-24-12-10-18)27(21)17-29-14-15-31(4,5)6/h16,18-19,24H,7-15,17H2,1-6H3/t19-/m0/s1 |
| InChIKey | AULNXJVOXNFVHD-IBGZPJMESA-N |
| XLogP | 4.73 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|