C22H33BrClN3O3Si — CID 67088802
tert-butyl 2-[5-bromo-4-chloro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 67088802) has the molecular formula C22H33BrClN3O3Si and a molecular weight of 530.97 g/mol. Its IUPAC name is tert-butyl 2-[5-bromo-4-chloro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[5-bromo-4-chloro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67088802 |
| Molecular Formula | C22H33BrClN3O3Si |
| Molecular Weight | 530.97 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | tert-butyl 2-[5-bromo-4-chloro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1nc2c(Cl)c(Br)ccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H33BrClN3O3Si/c1-22(2,3)30-21(28)26-11-7-8-17(26)20-25-19-16(10-9-15(23)18(19)24)27(20)14-29-12-13-31(4,5)6/h9-10,17H,7-8,11-14H2,1-6H3 |
| InChIKey | ZSIOHBPSKKUYTK-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.97 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|