C32H41BrN4O3Si — CID 76708811
tert-butyl 2-[5-[1-(4-bromophenyl)pyrrol-3-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 76708811) has the molecular formula C32H41BrN4O3Si and a molecular weight of 637.70 g/mol. Its IUPAC name is tert-butyl 2-[5-[1-(4-bromophenyl)pyrrol-3-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[5-[1-(4-bromophenyl)pyrrol-3-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 76708811 |
| Molecular Formula | C32H41BrN4O3Si |
| Molecular Weight | 637.70 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | tert-butyl 2-[5-[1-(4-bromophenyl)pyrrol-3-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1nc2cc(-c3ccn(-c4ccc(Br)cc4)c3)ccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C32H41BrN4O3Si/c1-32(2,3)40-31(38)36-16-7-8-29(36)30-34-27-20-23(9-14-28(27)37(30)22-39-18-19-41(4,5)6)24-15-17-35(21-24)26-12-10-25(33)11-13-26/h9-15,17,20-21,29H,7-8,16,18-19,22H2,1-6H3 |
| InChIKey | JCQMELNIQBIVMC-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 61.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.70 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|