C18H31Br2N3O3Si — CID 76783447
tert-butyl 2-[4,5-dibromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 76783447) has the molecular formula C18H31Br2N3O3Si and a molecular weight of 525.36 g/mol. Its IUPAC name is tert-butyl 2-[4,5-dibromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[4,5-dibromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 76783447 |
| Molecular Formula | C18H31Br2N3O3Si |
| Molecular Weight | 525.36 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | tert-butyl 2-[4,5-dibromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1nc(Br)c(Br)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H31Br2N3O3Si/c1-18(2,3)26-17(24)22-9-7-8-13(22)16-21-14(19)15(20)23(16)12-25-10-11-27(4,5)6/h13H,7-12H2,1-6H3 |
| InChIKey | GCPSTOBRMCBMFW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.36 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|