C33H40F3N5O6SSi — CID 57462125
tert-butyl (2S)-2-[5-[2-[6-(trifluoromethylsulfonyloxy)naphthalen-2-yl]pyrimidin-5-yl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 57462125) has the molecular formula C33H40F3N5O6SSi and a molecular weight of 719.86 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[2-[6-(trifluoromethylsulfonyloxy)naphthalen-2-yl]pyrimidin-5-yl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[2-[6-(trifluoromethylsulfonyloxy)naphthalen-2-yl]pyrimidin-5-yl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57462125 |
| Molecular Formula | C33H40F3N5O6SSi |
| Molecular Weight | 719.86 g/mol |
| Exact Mass | 719.24 |
| IUPAC Name | tert-butyl (2S)-2-[5-[2-[6-(trifluoromethylsulfonyloxy)naphthalen-2-yl]pyrimidin-5-yl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1ncc(-c2cnc(-c3ccc4cc(OS(=O)(=O)C(F)(F)F)ccc4c3)nc2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C33H40F3N5O6SSi/c1-32(2,3)46-31(42)40-13-7-8-27(40)30-39-20-28(41(30)21-45-14-15-49(4,5)6)25-18-37-29(38-19-25)24-10-9-23-17-26(12-11-22(23)16-24)47-48(43,44)33(34,35)36/h9-12,16-20,27H,7-8,13-15,21H2,1-6H3/t27-/m0/s1 |
| InChIKey | XQINNPHQDQNHBI-MHZLTWQESA-N |
| XLogP | 7.77 |
| TPSA | 125.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.86 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|