C28H39N3O4Si — CID 76547078
tert-butyl 2-[5-(6-hydroxynaphthalen-2-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 76547078) has the molecular formula C28H39N3O4Si and a molecular weight of 509.72 g/mol. Its IUPAC name is tert-butyl 2-[5-(6-hydroxynaphthalen-2-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[5-(6-hydroxynaphthalen-2-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 76547078 |
| Molecular Formula | C28H39N3O4Si |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | tert-butyl 2-[5-(6-hydroxynaphthalen-2-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1ncc(-c2ccc3cc(O)ccc3c2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C28H39N3O4Si/c1-28(2,3)35-27(33)30-13-7-8-24(30)26-29-18-25(31(26)19-34-14-15-36(4,5)6)22-10-9-21-17-23(32)12-11-20(21)16-22/h9-12,16-18,24,32H,7-8,13-15,19H2,1-6H3 |
| InChIKey | VDFTWXURMJQFRI-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|