C19H30ClN3O3Si — CID 175993151
4-[2-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxy-1-methylcyclohexan-1-ol (PubChem CID 175993151) has the molecular formula C19H30ClN3O3Si and a molecular weight of 412.01 g/mol. Its IUPAC name is 4-[2-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxy-1-methylcyclohexan-1-ol.
| Compound Name | 4-[2-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxy-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 175993151 |
| Molecular Formula | C19H30ClN3O3Si |
| Molecular Weight | 412.01 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 4-[2-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxy-1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCC(Oc2nc(Cl)nc3c2ccn3COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C19H30ClN3O3Si/c1-19(24)8-5-14(6-9-19)26-17-15-7-10-23(16(15)21-18(20)22-17)13-25-11-12-27(2,3)4/h7,10,14,24H,5-6,8-9,11-13H2,1-4H3 |
| InChIKey | DGRXEWWXGIRTQL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.01 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|