C18H25ClN4O3Si — CID 142416302
2-chloro-4-(oxan-4-yloxy)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile (PubChem CID 142416302) has the molecular formula C18H25ClN4O3Si and a molecular weight of 408.96 g/mol. Its IUPAC name is 2-chloro-4-(oxan-4-yloxy)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile.
| Compound Name | 2-chloro-4-(oxan-4-yloxy)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 142416302 |
| Molecular Formula | C18H25ClN4O3Si |
| Molecular Weight | 408.96 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2-chloro-4-(oxan-4-yloxy)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(C#N)c2c(OC3CCOCC3)nc(Cl)nc21 |
| InChI | InChI=1S/C18H25ClN4O3Si/c1-27(2,3)9-8-25-12-23-11-13(10-20)15-16(23)21-18(19)22-17(15)26-14-4-6-24-7-5-14/h11,14H,4-9,12H2,1-3H3 |
| InChIKey | VTBQNTCTYASNHS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.96 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|