C23H37ClN4O4Si — CID 123862710
tert-butyl N-[3-[2-chloro-5-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxycyclobutyl]-N-methylcarbamate (PubChem CID 123862710) has the molecular formula C23H37ClN4O4Si and a molecular weight of 497.11 g/mol. Its IUPAC name is tert-butyl N-[3-[2-chloro-5-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxycyclobutyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[2-chloro-5-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxycyclobutyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123862710 |
| Molecular Formula | C23H37ClN4O4Si |
| Molecular Weight | 497.11 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | tert-butyl N-[3-[2-chloro-5-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxycyclobutyl]-N-methylcarbamate |
| SMILES | Cc1cn(COCC[Si](C)(C)C)c2nc(Cl)nc(OC3CC(N(C)C(=O)OC(C)(C)C)C3)c12 |
| InChI | InChI=1S/C23H37ClN4O4Si/c1-15-13-28(14-30-9-10-33(6,7)8)19-18(15)20(26-21(24)25-19)31-17-11-16(12-17)27(5)22(29)32-23(2,3)4/h13,16-17H,9-12,14H2,1-8H3 |
| InChIKey | YPEAZDGDPWMONP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.11 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|