C22H35BrClN5O3Si — CID 175796446
tert-butyl (2S,4R)-4-[[5-bromo-2-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpyrrolidine-1-carboxylate (PubChem CID 175796446) has the molecular formula C22H35BrClN5O3Si and a molecular weight of 561.00 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[[5-bromo-2-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[[5-bromo-2-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175796446 |
| Molecular Formula | C22H35BrClN5O3Si |
| Molecular Weight | 561.00 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | tert-butyl (2S,4R)-4-[[5-bromo-2-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@H]1C[C@@H](Nc2nc(Cl)nc3c2c(Br)cn3COCC[Si](C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35BrClN5O3Si/c1-14-10-15(11-29(14)21(30)32-22(2,3)4)25-18-17-16(23)12-28(19(17)27-20(24)26-18)13-31-8-9-33(5,6)7/h12,14-15H,8-11,13H2,1-7H3,(H,25,26,27)/t14-,15+/m0/s1 |
| InChIKey | BITFHHQBCZVGBX-LSDHHAIUSA-N |
| XLogP | 5.97 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.00 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|