C18H29ClN6O3Si — CID 175047121
(2S,5R)-5-[[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-2-methylpiperidine-1-carboxylic acid (PubChem CID 175047121) has the molecular formula C18H29ClN6O3Si and a molecular weight of 441.01 g/mol. Its IUPAC name is (2S,5R)-5-[[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-2-methylpiperidine-1-carboxylic acid.
| Compound Name | (2S,5R)-5-[[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-2-methylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175047121 |
| Molecular Formula | C18H29ClN6O3Si |
| Molecular Weight | 441.01 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (2S,5R)-5-[[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-2-methylpiperidine-1-carboxylic acid |
| SMILES | C[C@H]1CC[C@@H](Nc2nc(Cl)nc3c2cnn3COCC[Si](C)(C)C)CN1C(=O)O |
| InChI | InChI=1S/C18H29ClN6O3Si/c1-12-5-6-13(10-24(12)18(26)27)21-15-14-9-20-25(16(14)23-17(19)22-15)11-28-7-8-29(2,3)4/h9,12-13H,5-8,10-11H2,1-4H3,(H,26,27)(H,21,22,23)/t12-,13+/m0/s1 |
| InChIKey | QCOUDJYOHLFKDF-QWHCGFSZSA-N |
| XLogP | 3.73 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.01 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|