C23H34LiN7O4Si — CID 168853597
lithium 1-methoxy-4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-6-yl]cyclohexane-1-carboxylate (PubChem CID 168853597) has the molecular formula C23H34LiN7O4Si and a molecular weight of 507.60 g/mol. Its IUPAC name is lithium 1-methoxy-4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-6-yl]cyclohexane-1-carboxylate.
| Compound Name | lithium 1-methoxy-4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-6-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 168853597 |
| Molecular Formula | C23H34LiN7O4Si |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | lithium 1-methoxy-4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-6-yl]cyclohexane-1-carboxylate |
| SMILES | COC1(C(=O)[O-])CCC(c2nc(Nc3cc(C)[nH]n3)c3cnn(COCC[Si](C)(C)C)c3n2)CC1.[Li+] |
| InChI | InChI=1S/C23H35N7O4Si.Li/c1-15-12-18(29-28-15)25-20-17-13-24-30(14-34-10-11-35(3,4)5)21(17)27-19(26-20)16-6-8-23(33-2,9-7-16)22(31)32;/h12-13,16H,6-11,14H2,1-5H3,(H,31,32)(H2,25,26,27,28,29);/q;+1/p-1 |
| InChIKey | PEMURRRKPIALPH-UHFFFAOYSA-M |
| XLogP | -0.29 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|