C22H38N6O3Si — CID 86666961
tert-butyl N-[(3R,5S)-5-methyl-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperidin-3-yl]carbamate (PubChem CID 86666961) has the molecular formula C22H38N6O3Si and a molecular weight of 462.67 g/mol. Its IUPAC name is tert-butyl N-[(3R,5S)-5-methyl-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,5S)-5-methyl-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86666961 |
| Molecular Formula | C22H38N6O3Si |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | tert-butyl N-[(3R,5S)-5-methyl-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-d]pyrimidin-4-yl]piperidin-3-yl]carbamate |
| SMILES | C[C@H]1C[C@@H](NC(=O)OC(C)(C)C)CN(c2ncnc3c2cnn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C22H38N6O3Si/c1-16-10-17(26-21(29)31-22(2,3)4)13-27(12-16)19-18-11-25-28(20(18)24-14-23-19)15-30-8-9-32(5,6)7/h11,14,16-17H,8-10,12-13,15H2,1-7H3,(H,26,29)/t16-,17+/m0/s1 |
| InChIKey | LSNSZIZQPDSVQU-DLBZAZTESA-N |
| XLogP | 3.88 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|