C24H39IN6O4Si — CID 175800265
tert-butyl N-[8-[5-(hydroxymethyl)-3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyrazin-6-yl]-8-azabicyclo[3.2.1]octan-3-yl]carbamate (PubChem CID 175800265) has the molecular formula C24H39IN6O4Si and a molecular weight of 630.60 g/mol. Its IUPAC name is tert-butyl N-[8-[5-(hydroxymethyl)-3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyrazin-6-yl]-8-azabicyclo[3.2.1]octan-3-yl]carbamate.
| Compound Name | tert-butyl N-[8-[5-(hydroxymethyl)-3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyrazin-6-yl]-8-azabicyclo[3.2.1]octan-3-yl]carbamate |
|---|---|
| PubChem CID | 175800265 |
| Molecular Formula | C24H39IN6O4Si |
| Molecular Weight | 630.60 g/mol |
| Exact Mass | 630.18 |
| IUPAC Name | tert-butyl N-[8-[5-(hydroxymethyl)-3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyrazin-6-yl]-8-azabicyclo[3.2.1]octan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC2CCC(C1)N2c1nc2c(nc1CO)c(I)nn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H39IN6O4Si/c1-24(2,3)35-23(33)26-15-11-16-7-8-17(12-15)31(16)21-18(13-32)27-19-20(25)29-30(22(19)28-21)14-34-9-10-36(4,5)6/h15-17,32H,7-14H2,1-6H3,(H,26,33) |
| InChIKey | BRTZCNGNIIBBPW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|