C24H38FIN6O4Si — CID 172800061
tert-butyl N-[(1S,2S,3S,5R)-2-fluoro-8-[5-(hydroxymethyl)-3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyrazin-6-yl]-8-azabicyclo[3.2.1]octan-3-yl]carbamate (PubChem CID 172800061) has the molecular formula C24H38FIN6O4Si and a molecular weight of 648.59 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S,3S,5R)-2-fluoro-8-[5-(hydroxymethyl)-3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyrazin-6-yl]-8-azabicyclo[3.2.1]octan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S,3S,5R)-2-fluoro-8-[5-(hydroxymethyl)-3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyrazin-6-yl]-8-azabicyclo[3.2.1]octan-3-yl]carbamate |
|---|---|
| PubChem CID | 172800061 |
| Molecular Formula | C24H38FIN6O4Si |
| Molecular Weight | 648.59 g/mol |
| Exact Mass | 648.18 |
| IUPAC Name | tert-butyl N-[(1S,2S,3S,5R)-2-fluoro-8-[5-(hydroxymethyl)-3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyrazin-6-yl]-8-azabicyclo[3.2.1]octan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H]2CC[C@@H]([C@H]1F)N2c1nc2c(nc1CO)c(I)nn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H38FIN6O4Si/c1-24(2,3)36-23(34)28-15-11-14-7-8-17(18(15)25)32(14)21-16(12-33)27-19-20(26)30-31(22(19)29-21)13-35-9-10-37(4,5)6/h14-15,17-18,33H,7-13H2,1-6H3,(H,28,34)/t14-,15+,17+,18+/m1/s1 |
| InChIKey | QSWUSASLAXLABS-FZCLSBEQSA-N |
| XLogP | 4.21 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|