C22H36N6O3Si — CID 169113609
N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-2-[(2S,5S)-2-ethyl-5-methylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 169113609) has the molecular formula C22H36N6O3Si and a molecular weight of 460.66 g/mol. Its IUPAC name is N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-2-[(2S,5S)-2-ethyl-5-methylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-2-[(2S,5S)-2-ethyl-5-methylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 169113609 |
| Molecular Formula | C22H36N6O3Si |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-2-[(2S,5S)-2-ethyl-5-methylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | CC[C@H]1CC[C@H](C)CN1C(=O)C(=O)Nc1cnc(N)c2cnn(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C22H36N6O3Si/c1-6-16-8-7-15(2)13-27(16)22(30)21(29)26-18-12-24-20(23)17-11-25-28(19(17)18)14-31-9-10-32(3,4)5/h11-12,15-16H,6-10,13-14H2,1-5H3,(H2,23,24)(H,26,29)/t15-,16-/m0/s1 |
| InChIKey | URFDFXAZJZOYFP-HOTGVXAUSA-N |
| XLogP | 3.30 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|