C25H36N6O3Si — CID 169112095
N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-N'-benzyl-N'-(2-methylpropyl)oxamide (PubChem CID 169112095) has the molecular formula C25H36N6O3Si and a molecular weight of 496.69 g/mol. Its IUPAC name is N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-N'-benzyl-N'-(2-methylpropyl)oxamide.
| Compound Name | N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-N'-benzyl-N'-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 169112095 |
| Molecular Formula | C25H36N6O3Si |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-N'-benzyl-N'-(2-methylpropyl)oxamide |
| SMILES | CC(C)CN(Cc1ccccc1)C(=O)C(=O)Nc1cnc(N)c2cnn(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C25H36N6O3Si/c1-18(2)15-30(16-19-9-7-6-8-10-19)25(33)24(32)29-21-14-27-23(26)20-13-28-31(22(20)21)17-34-11-12-35(3,4)5/h6-10,13-14,18H,11-12,15-17H2,1-5H3,(H2,26,27)(H,29,32) |
| InChIKey | KHQSPWZYRPKSRV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|