C28H32F3N7O3Si — CID 169111023
N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-N'-benzyl-N'-[[6-(trifluoromethyl)-2-pyridinyl]methyl]oxamide (PubChem CID 169111023) has the molecular formula C28H32F3N7O3Si and a molecular weight of 599.69 g/mol. Its IUPAC name is N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-N'-benzyl-N'-[[6-(trifluoromethyl)-2-pyridinyl]methyl]oxamide.
| Compound Name | N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-N'-benzyl-N'-[[6-(trifluoromethyl)-2-pyridinyl]methyl]oxamide |
|---|---|
| PubChem CID | 169111023 |
| Molecular Formula | C28H32F3N7O3Si |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-N'-benzyl-N'-[[6-(trifluoromethyl)-2-pyridinyl]methyl]oxamide |
| SMILES | C[Si](C)(C)CCOCn1ncc2c(N)ncc(NC(=O)C(=O)N(Cc3ccccc3)Cc3cccc(C(F)(F)F)n3)c21 |
| InChI | InChI=1S/C28H32F3N7O3Si/c1-42(2,3)13-12-41-18-38-24-21(14-34-38)25(32)33-15-22(24)36-26(39)27(40)37(16-19-8-5-4-6-9-19)17-20-10-7-11-23(35-20)28(29,30)31/h4-11,14-15H,12-13,16-18H2,1-3H3,(H2,32,33)(H,36,39) |
| InChIKey | LQQNFRPMFQAZMG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|