C26H36N6O3Si — CID 174094379
N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-2-[(2R,3R)-3-methyl-2-phenylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 174094379) has the molecular formula C26H36N6O3Si and a molecular weight of 508.70 g/mol. Its IUPAC name is N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-2-[(2R,3R)-3-methyl-2-phenylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-2-[(2R,3R)-3-methyl-2-phenylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 174094379 |
| Molecular Formula | C26H36N6O3Si |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-2-[(2R,3R)-3-methyl-2-phenylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | C[C@@H]1CCCN(C(=O)C(=O)Nc2cnc(N)c3cnn(COCC[Si](C)(C)C)c23)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H36N6O3Si/c1-18-9-8-12-31(22(18)19-10-6-5-7-11-19)26(34)25(33)30-21-16-28-24(27)20-15-29-32(23(20)21)17-35-13-14-36(2,3)4/h5-7,10-11,15-16,18,22H,8-9,12-14,17H2,1-4H3,(H2,27,28)(H,30,33)/t18-,22-/m1/s1 |
| InChIKey | UOTCFJFQGRQUMZ-XMSQKQJNSA-N |
| XLogP | 4.26 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|