C31H47N7O4Si — CID 174054461
N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-2-[(2R,5S)-2-[3-[2-(dimethylamino)propoxy]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 174054461) has the molecular formula C31H47N7O4Si and a molecular weight of 609.85 g/mol. Its IUPAC name is N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-2-[(2R,5S)-2-[3-[2-(dimethylamino)propoxy]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-2-[(2R,5S)-2-[3-[2-(dimethylamino)propoxy]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 174054461 |
| Molecular Formula | C31H47N7O4Si |
| Molecular Weight | 609.85 g/mol |
| Exact Mass | 609.35 |
| IUPAC Name | N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-2-[(2R,5S)-2-[3-[2-(dimethylamino)propoxy]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | CC(COc1cccc([C@H]2CC[C@H](C)CN2C(=O)C(=O)Nc2cnc(N)c3cnn(COCC[Si](C)(C)C)c23)c1)N(C)C |
| InChI | InChI=1S/C31H47N7O4Si/c1-21-11-12-27(23-9-8-10-24(15-23)42-19-22(2)36(3)4)37(18-21)31(40)30(39)35-26-17-33-29(32)25-16-34-38(28(25)26)20-41-13-14-43(5,6)7/h8-10,15-17,21-22,27H,11-14,18-20H2,1-7H3,(H2,32,33)(H,35,39)/t21-,22?,27+/m0/s1 |
| InChIKey | WBPNVHDYZCOUPT-IOAOJOEPSA-N |
| XLogP | 4.59 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.85 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|