C50H70N10O6 — CID 165060620
N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2R,5S)-2-[3-[2-(dimethylamino)ethoxy]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 165060620) has the molecular formula C50H70N10O6 and a molecular weight of 907.17 g/mol. Its IUPAC name is N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2R,5S)-2-[3-[2-(dimethylamino)ethoxy]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2R,5S)-2-[3-[2-(dimethylamino)ethoxy]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 165060620 |
| Molecular Formula | C50H70N10O6 |
| Molecular Weight | 907.17 g/mol |
| Exact Mass | 906.55 |
| IUPAC Name | N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2R,5S)-2-[3-[2-(dimethylamino)ethoxy]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | CCc1cc(NC(=O)C(=O)N2C[C@@H](C)CC[C@@H]2c2cccc(OCCN(C)C)c2)cnc1N.CCc1cc(NC(=O)C(=O)N2C[C@@H](C)CC[C@@H]2c2cccc(OCCN(C)C)c2)cnc1N |
| InChI | InChI=1S/2C25H35N5O3/c2*1-5-18-13-20(15-27-23(18)26)28-24(31)25(32)30-16-17(2)9-10-22(30)19-7-6-8-21(14-19)33-12-11-29(3)4/h2*6-8,13-15,17,22H,5,9-12,16H2,1-4H3,(H2,26,27)(H,28,31)/t2*17-,22+/m00/s1 |
| InChIKey | RDENKGDPORFOGN-UHDULWDZSA-N |
| XLogP | 6.21 |
| TPSA | 201.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.17 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|