C26H37N5O3 — CID 164751984
N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2R,5S)-2-[3-[3-(dimethylamino)propoxy]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 164751984) has the molecular formula C26H37N5O3 and a molecular weight of 467.61 g/mol. Its IUPAC name is N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2R,5S)-2-[3-[3-(dimethylamino)propoxy]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2R,5S)-2-[3-[3-(dimethylamino)propoxy]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 164751984 |
| Molecular Formula | C26H37N5O3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2R,5S)-2-[3-[3-(dimethylamino)propoxy]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | CCc1cc(NC(=O)C(=O)N2C[C@@H](C)CC[C@@H]2c2cccc(OCCCN(C)C)c2)cnc1N |
| InChI | InChI=1S/C26H37N5O3/c1-5-19-14-21(16-28-24(19)27)29-25(32)26(33)31-17-18(2)10-11-23(31)20-8-6-9-22(15-20)34-13-7-12-30(3)4/h6,8-9,14-16,18,23H,5,7,10-13,17H2,1-4H3,(H2,27,28)(H,29,32)/t18-,23+/m0/s1 |
| InChIKey | HMJIXLHRCDSPON-FDDCHVKYSA-N |
| XLogP | 3.49 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|