C25H36N6O3Si- — CID 169111772
CID 169111772 (PubChem CID 169111772) has the molecular formula C25H36N6O3Si- and a molecular weight of 496.69 g/mol.
| Compound Name | CID 169111772 |
|---|---|
| PubChem CID | 169111772 |
| Molecular Formula | C25H36N6O3Si- |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | — |
| SMILES | CCC(C)N(Cc1ccccc1)C(=O)C(=O)Nc1cnc(N)c2cnn(COCC[Si-](C)(C)C)c12 |
| InChI | InChI=1S/C25H36N6O3Si/c1-6-18(2)30(16-19-10-8-7-9-11-19)25(33)24(32)29-21-15-27-23(26)20-14-28-31(22(20)21)17-34-12-13-35(3,4)5/h7-11,14-15,18H,6,12-13,16-17H2,1-5H3,(H2,26,27)(H,29,32)/q-1 |
| InChIKey | VPFYTYWUGCTFSM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|