C21H25N7O2 — CID 170197382
N-(4-amino-1H-pyrazolo[4,5-c]pyridin-7-yl)-N'-benzyl-N'-[(Z)-2-(dimethylamino)but-2-enyl]oxamide (PubChem CID 170197382) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is N-(4-amino-1H-pyrazolo[4,5-c]pyridin-7-yl)-N'-benzyl-N'-[(Z)-2-(dimethylamino)but-2-enyl]oxamide.
| Compound Name | N-(4-amino-1H-pyrazolo[4,5-c]pyridin-7-yl)-N'-benzyl-N'-[(Z)-2-(dimethylamino)but-2-enyl]oxamide |
|---|---|
| PubChem CID | 170197382 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-(4-amino-1H-pyrazolo[4,5-c]pyridin-7-yl)-N'-benzyl-N'-[(Z)-2-(dimethylamino)but-2-enyl]oxamide |
| SMILES | C/C=C(/CN(Cc1ccccc1)C(=O)C(=O)Nc1cnc(N)c2cn[nH]c12)N(C)C |
| InChI | InChI=1S/C21H25N7O2/c1-4-15(27(2)3)13-28(12-14-8-6-5-7-9-14)21(30)20(29)25-17-11-23-19(22)16-10-24-26-18(16)17/h4-11H,12-13H2,1-3H3,(H2,22,23)(H,24,26)(H,25,29)/b15-4- |
| InChIKey | HHOHUUUOXJAUPE-TVPGTPATSA-N |
| XLogP | 1.97 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|