C21H21N7O2 — CID 169111906
N-(4-amino-1H-pyrazolo[4,5-c]pyridin-7-yl)-N'-benzyl-N'-[(2E)-2-[(methylideneamino)methylidene]but-3-enyl]oxamide (PubChem CID 169111906) has the molecular formula C21H21N7O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is N-(4-amino-1H-pyrazolo[4,5-c]pyridin-7-yl)-N'-benzyl-N'-[(2E)-2-[(methylideneamino)methylidene]but-3-enyl]oxamide.
| Compound Name | N-(4-amino-1H-pyrazolo[4,5-c]pyridin-7-yl)-N'-benzyl-N'-[(2E)-2-[(methylideneamino)methylidene]but-3-enyl]oxamide |
|---|---|
| PubChem CID | 169111906 |
| Molecular Formula | C21H21N7O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-(4-amino-1H-pyrazolo[4,5-c]pyridin-7-yl)-N'-benzyl-N'-[(2E)-2-[(methylideneamino)methylidene]but-3-enyl]oxamide |
| SMILES | C=C/C(=C\N=C)CN(Cc1ccccc1)C(=O)C(=O)Nc1cnc(N)c2cn[nH]c12 |
| InChI | InChI=1S/C21H21N7O2/c1-3-14(9-23-2)12-28(13-15-7-5-4-6-8-15)21(30)20(29)26-17-11-24-19(22)16-10-25-27-18(16)17/h3-11H,1-2,12-13H2,(H2,22,24)(H,25,27)(H,26,29)/b14-9+ |
| InChIKey | WIPIKLHLIWRUAQ-NTEUORMPSA-N |
| XLogP | 2.28 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|