C19H29ClN4OSi — CID 177211662
2-[[2-chloro-4-(1-ethyl-3-azabicyclo[3.1.0]hexan-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 177211662) has the molecular formula C19H29ClN4OSi and a molecular weight of 393.01 g/mol. Its IUPAC name is 2-[[2-chloro-4-(1-ethyl-3-azabicyclo[3.1.0]hexan-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-chloro-4-(1-ethyl-3-azabicyclo[3.1.0]hexan-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 177211662 |
| Molecular Formula | C19H29ClN4OSi |
| Molecular Weight | 393.01 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[[2-chloro-4-(1-ethyl-3-azabicyclo[3.1.0]hexan-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCC12CC1CN(c1nc(Cl)nc3c1ccn3COCC[Si](C)(C)C)C2 |
| InChI | InChI=1S/C19H29ClN4OSi/c1-5-19-10-14(19)11-24(12-19)17-15-6-7-23(16(15)21-18(20)22-17)13-25-8-9-26(2,3)4/h6-7,14H,5,8-13H2,1-4H3 |
| InChIKey | XVSPRTBJAHCIHZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.01 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|