C26H33N5OSi — CID 177211682
3-[4-(1-ethyl-3-azabicyclo[3.1.0]hexan-3-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]benzonitrile (PubChem CID 177211682) has the molecular formula C26H33N5OSi and a molecular weight of 459.67 g/mol. Its IUPAC name is 3-[4-(1-ethyl-3-azabicyclo[3.1.0]hexan-3-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]benzonitrile.
| Compound Name | 3-[4-(1-ethyl-3-azabicyclo[3.1.0]hexan-3-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 177211682 |
| Molecular Formula | C26H33N5OSi |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 3-[4-(1-ethyl-3-azabicyclo[3.1.0]hexan-3-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]benzonitrile |
| SMILES | CCC12CC1CN(c1ncnc3c1c(-c1cccc(C#N)c1)cn3COCC[Si](C)(C)C)C2 |
| InChI | InChI=1S/C26H33N5OSi/c1-5-26-12-21(26)14-30(16-26)24-23-22(20-8-6-7-19(11-20)13-27)15-31(25(23)29-17-28-24)18-32-9-10-33(2,3)4/h6-8,11,15,17,21H,5,9-10,12,14,16,18H2,1-4H3 |
| InChIKey | ALHWYJUYOSCRRU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|