C14H27NO2Si — CID 91419516
diethoxy-[3-(1-ethylpyrrol-2-yl)propyl]-methylsilane (PubChem CID 91419516) has the molecular formula C14H27NO2Si and a molecular weight of 269.46 g/mol. Its IUPAC name is diethoxy-[3-(1-ethylpyrrol-2-yl)propyl]-methylsilane.
| Compound Name | diethoxy-[3-(1-ethylpyrrol-2-yl)propyl]-methylsilane |
|---|---|
| PubChem CID | 91419516 |
| Molecular Formula | C14H27NO2Si |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | diethoxy-[3-(1-ethylpyrrol-2-yl)propyl]-methylsilane |
| SMILES | CCO[Si](C)(CCCc1cccn1CC)OCC |
| InChI | InChI=1S/C14H27NO2Si/c1-5-15-12-8-10-14(15)11-9-13-18(4,16-6-2)17-7-3/h8,10,12H,5-7,9,11,13H2,1-4H3 |
| InChIKey | LISHGDUXZFUNPY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|