C14H22F2O2Si — CID 90172780
3-(3,4-difluorophenyl)propyl-diethoxy-methylsilane (PubChem CID 90172780) has the molecular formula C14H22F2O2Si and a molecular weight of 288.41 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)propyl-diethoxy-methylsilane.
| Compound Name | 3-(3,4-difluorophenyl)propyl-diethoxy-methylsilane |
|---|---|
| PubChem CID | 90172780 |
| Molecular Formula | C14H22F2O2Si |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-(3,4-difluorophenyl)propyl-diethoxy-methylsilane |
| SMILES | CCO[Si](C)(CCCc1ccc(F)c(F)c1)OCC |
| InChI | InChI=1S/C14H22F2O2Si/c1-4-17-19(3,18-5-2)10-6-7-12-8-9-13(15)14(16)11-12/h8-9,11H,4-7,10H2,1-3H3 |
| InChIKey | CCNZMFFICVGTQZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|