C30H48N6O3Si2 — CID 67163688
N,N-bis[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide (PubChem CID 67163688) has the molecular formula C30H48N6O3Si2 and a molecular weight of 596.93 g/mol. Its IUPAC name is N,N-bis[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide.
| Compound Name | N,N-bis[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 67163688 |
| Molecular Formula | C30H48N6O3Si2 |
| Molecular Weight | 596.93 g/mol |
| Exact Mass | 596.33 |
| IUPAC Name | N,N-bis[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1ccnc1CN(Cc1nccn1COCC[Si](C)(C)C)C(=O)c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C30H48N6O3Si2/c1-40(2,3)17-15-38-23-34-13-11-32-28(34)21-36(30(37)26-7-8-27-20-31-10-9-25(27)19-26)22-29-33-12-14-35(29)24-39-16-18-41(4,5)6/h7-8,11-14,19,31H,9-10,15-18,20-24H2,1-6H3 |
| InChIKey | QEZZQWJAEKQGLI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.93 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|