C14H22F2N2O2Si — CID 164860021
(3,3-difluorocyclobutyl)-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanone (PubChem CID 164860021) has the molecular formula C14H22F2N2O2Si and a molecular weight of 316.42 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanone.
| Compound Name | (3,3-difluorocyclobutyl)-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanone |
|---|---|
| PubChem CID | 164860021 |
| Molecular Formula | C14H22F2N2O2Si |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (3,3-difluorocyclobutyl)-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanone |
| SMILES | C[Si](C)(C)CCOCn1ccnc1C(=O)C1CC(F)(F)C1 |
| InChI | InChI=1S/C14H22F2N2O2Si/c1-21(2,3)7-6-20-10-18-5-4-17-13(18)12(19)11-8-14(15,16)9-11/h4-5,11H,6-10H2,1-3H3 |
| InChIKey | FUQMDHOYVUKWHD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|