C7H10BrN3O — CID 136951143
(NE)-N-[[1-(3-bromopropyl)imidazol-2-yl]methylidene]hydroxylamine (PubChem CID 136951143) has the molecular formula C7H10BrN3O and a molecular weight of 232.08 g/mol. Its IUPAC name is (NE)-N-[[1-(3-bromopropyl)imidazol-2-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[1-(3-bromopropyl)imidazol-2-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 136951143 |
| Molecular Formula | C7H10BrN3O |
| Molecular Weight | 232.08 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | (NE)-N-[[1-(3-bromopropyl)imidazol-2-yl]methylidene]hydroxylamine |
| SMILES | O/N=C/c1nccn1CCCBr |
| InChI | InChI=1S/C7H10BrN3O/c8-2-1-4-11-5-3-9-7(11)6-10-12/h3,5-6,12H,1-2,4H2/b10-6+ |
| InChIKey | LSJITZBYGIPZAZ-UXBLZVDNSA-N |
| XLogP | 1.48 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.08 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|