C17H25BrN2O5SSi — CID 166521495
methyl 3-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]sulfonylpropanoate (PubChem CID 166521495) has the molecular formula C17H25BrN2O5SSi and a molecular weight of 477.45 g/mol. Its IUPAC name is methyl 3-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]sulfonylpropanoate.
| Compound Name | methyl 3-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]sulfonylpropanoate |
|---|---|
| PubChem CID | 166521495 |
| Molecular Formula | C17H25BrN2O5SSi |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | methyl 3-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]sulfonylpropanoate |
| SMILES | COC(=O)CCS(=O)(=O)c1nc2c(ccn2COCC[Si](C)(C)C)cc1Br |
| InChI | InChI=1S/C17H25BrN2O5SSi/c1-24-15(21)6-9-26(22,23)17-14(18)11-13-5-7-20(16(13)19-17)12-25-8-10-27(2,3)4/h5,7,11H,6,8-10,12H2,1-4H3 |
| InChIKey | QSDZFDVETVTYNY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|