C22H34N4O4Si — CID 176892917
tert-butyl N-[5-(cyclopropylcarbamoyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]carbamate (PubChem CID 176892917) has the molecular formula C22H34N4O4Si and a molecular weight of 446.62 g/mol. Its IUPAC name is tert-butyl N-[5-(cyclopropylcarbamoyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]carbamate.
| Compound Name | tert-butyl N-[5-(cyclopropylcarbamoyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]carbamate |
|---|---|
| PubChem CID | 176892917 |
| Molecular Formula | C22H34N4O4Si |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | tert-butyl N-[5-(cyclopropylcarbamoyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc2c(ccn2COCC[Si](C)(C)C)cc1C(=O)NC1CC1 |
| InChI | InChI=1S/C22H34N4O4Si/c1-22(2,3)30-21(28)25-18-17(20(27)23-16-7-8-16)13-15-9-10-26(19(15)24-18)14-29-11-12-31(4,5)6/h9-10,13,16H,7-8,11-12,14H2,1-6H3,(H,23,27)(H,24,25,28) |
| InChIKey | UZSWPQSHSOQUHM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|