C21H34N4O3Si — CID 174107603
4-[1-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]piperidin-4-yl]butanoic acid (PubChem CID 174107603) has the molecular formula C21H34N4O3Si and a molecular weight of 418.61 g/mol. Its IUPAC name is 4-[1-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]piperidin-4-yl]butanoic acid.
| Compound Name | 4-[1-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]piperidin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 174107603 |
| Molecular Formula | C21H34N4O3Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 4-[1-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]piperidin-4-yl]butanoic acid |
| SMILES | C[Si](C)(C)CCOCn1ccc2cnc(N3CCC(CCCC(=O)O)CC3)nc21 |
| InChI | InChI=1S/C21H34N4O3Si/c1-29(2,3)14-13-28-16-25-12-9-18-15-22-21(23-20(18)25)24-10-7-17(8-11-24)5-4-6-19(26)27/h9,12,15,17H,4-8,10-11,13-14,16H2,1-3H3,(H,26,27) |
| InChIKey | YKHJHIDQVLGSCZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|