C25H32IN3O6Si — CID 150074414
methyl 2-[(2-iodo-4,5-dimethoxybenzoyl)-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]acetate (PubChem CID 150074414) has the molecular formula C25H32IN3O6Si and a molecular weight of 625.54 g/mol. Its IUPAC name is methyl 2-[(2-iodo-4,5-dimethoxybenzoyl)-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]acetate.
| Compound Name | methyl 2-[(2-iodo-4,5-dimethoxybenzoyl)-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 150074414 |
| Molecular Formula | C25H32IN3O6Si |
| Molecular Weight | 625.54 g/mol |
| Exact Mass | 625.11 |
| IUPAC Name | methyl 2-[(2-iodo-4,5-dimethoxybenzoyl)-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]acetate |
| SMILES | COC(=O)CN(C(=O)c1cc(OC)c(OC)cc1I)c1ccnc2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C25H32IN3O6Si/c1-32-21-13-18(19(26)14-22(21)33-2)25(31)29(15-23(30)34-3)20-7-9-27-24-17(20)8-10-28(24)16-35-11-12-36(4,5)6/h7-10,13-14H,11-12,15-16H2,1-6H3 |
| InChIKey | DPYNPNSSOVUPIF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 92.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|