C23H30F2N4O4Si — CID 162141681
1-[3,5-difluoro-4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(2-methoxyethyl)urea (PubChem CID 162141681) has the molecular formula C23H30F2N4O4Si and a molecular weight of 492.60 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[3,5-difluoro-4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 162141681 |
| Molecular Formula | C23H30F2N4O4Si |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 1-[3,5-difluoro-4-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxyphenyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)Nc1cc(F)c(Oc2ccnc3c2ccn3COCC[Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C23H30F2N4O4Si/c1-31-10-8-27-23(30)28-16-13-18(24)21(19(25)14-16)33-20-5-7-26-22-17(20)6-9-29(22)15-32-11-12-34(2,3)4/h5-7,9,13-14H,8,10-12,15H2,1-4H3,(H2,27,28,30) |
| InChIKey | ZJZUVQGEMBLBLP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|