C21H28ClN3O5SSi — CID 150833204
2-[[4-(2-chloro-4,5-dimethoxyphenyl)-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 150833204) has the molecular formula C21H28ClN3O5SSi and a molecular weight of 498.08 g/mol. Its IUPAC name is 2-[[4-(2-chloro-4,5-dimethoxyphenyl)-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(2-chloro-4,5-dimethoxyphenyl)-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 150833204 |
| Molecular Formula | C21H28ClN3O5SSi |
| Molecular Weight | 498.08 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2-[[4-(2-chloro-4,5-dimethoxyphenyl)-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc(Cl)c(-c2nc(S(C)(=O)=O)nc3c2ccn3COCC[Si](C)(C)C)cc1OC |
| InChI | InChI=1S/C21H28ClN3O5SSi/c1-28-17-11-15(16(22)12-18(17)29-2)19-14-7-8-25(13-30-9-10-32(4,5)6)20(14)24-21(23-19)31(3,26)27/h7-8,11-12H,9-10,13H2,1-6H3 |
| InChIKey | KMKLIUFJHWCCDF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.08 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|