C14H19N3OSi — CID 58243790
1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonitrile (PubChem CID 58243790) has the molecular formula C14H19N3OSi and a molecular weight of 273.41 g/mol. Its IUPAC name is 1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 58243790 |
| Molecular Formula | C14H19N3OSi |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2cc(C#N)cnc21 |
| InChI | InChI=1S/C14H19N3OSi/c1-19(2,3)7-6-18-11-17-5-4-13-8-12(9-15)10-16-14(13)17/h4-5,8,10H,6-7,11H2,1-3H3 |
| InChIKey | HGEOIHBHNFVICR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|