C20H22N4O3Si — CID 140914971
4-(1,3-benzodioxol-5-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-2-carbonitrile (PubChem CID 140914971) has the molecular formula C20H22N4O3Si and a molecular weight of 394.51 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-2-carbonitrile.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 140914971 |
| Molecular Formula | C20H22N4O3Si |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-2-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3ccc4c(c3)OCO4)nc(C#N)nc21 |
| InChI | InChI=1S/C20H22N4O3Si/c1-28(2,3)9-8-25-12-24-7-6-15-19(22-18(11-21)23-20(15)24)14-4-5-16-17(10-14)27-13-26-16/h4-7,10H,8-9,12-13H2,1-3H3 |
| InChIKey | LVSYKFGXWRQICH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 82.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|