C27H29N5OSi — CID 140775640
2-[5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-3-pyridinyl]-1,3-dihydroindene-2-carbonitrile (PubChem CID 140775640) has the molecular formula C27H29N5OSi and a molecular weight of 467.65 g/mol. Its IUPAC name is 2-[5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-3-pyridinyl]-1,3-dihydroindene-2-carbonitrile.
| Compound Name | 2-[5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-3-pyridinyl]-1,3-dihydroindene-2-carbonitrile |
|---|---|
| PubChem CID | 140775640 |
| Molecular Formula | C27H29N5OSi |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 2-[5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-3-pyridinyl]-1,3-dihydroindene-2-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cncc(C4(C#N)Cc5ccccc5C4)c3)ncnc21 |
| InChI | InChI=1S/C27H29N5OSi/c1-34(2,3)11-10-33-19-32-9-8-24-25(30-18-31-26(24)32)22-12-23(16-29-15-22)27(17-28)13-20-6-4-5-7-21(20)14-27/h4-9,12,15-16,18H,10-11,13-14,19H2,1-3H3 |
| InChIKey | OKBOGPBTGUXWFQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|