C22H28BrIN2O5Si — CID 174612369
5-bromo-1-iodo-6-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;trimethyl-[2-(pyrrolo[2,3-b]pyridin-1-ylmethoxy)ethyl]silane (PubChem CID 174612369) has the molecular formula C22H28BrIN2O5Si and a molecular weight of 635.37 g/mol. Its IUPAC name is 5-bromo-1-iodo-6-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;trimethyl-[2-(pyrrolo[2,3-b]pyridin-1-ylmethoxy)ethyl]silane.
| Compound Name | 5-bromo-1-iodo-6-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;trimethyl-[2-(pyrrolo[2,3-b]pyridin-1-ylmethoxy)ethyl]silane |
|---|---|
| PubChem CID | 174612369 |
| Molecular Formula | C22H28BrIN2O5Si |
| Molecular Weight | 635.37 g/mol |
| Exact Mass | 634.00 |
| IUPAC Name | 5-bromo-1-iodo-6-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;trimethyl-[2-(pyrrolo[2,3-b]pyridin-1-ylmethoxy)ethyl]silane |
| SMILES | CC1=C(Br)C=C(C(=O)O)CC1(I)C(=O)O.C[Si](C)(C)CCOCn1ccc2cccnc21 |
| InChI | InChI=1S/C13H20N2OSi.C9H8BrIO4/c1-17(2,3)10-9-16-11-15-8-6-12-5-4-7-14-13(12)15;1-4-6(10)2-5(7(12)13)3-9(4,11)8(14)15/h4-8H,9-11H2,1-3H3;2H,3H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | UBUCBRZPUCEYBF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.37 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|