C12H18N2OSi — CID 153406221
trimethyl(2-pyrrolo[2,3-b]pyridin-1-yloxyethyl)silane (PubChem CID 153406221) has the molecular formula C12H18N2OSi and a molecular weight of 234.38 g/mol. Its IUPAC name is trimethyl(2-pyrrolo[2,3-b]pyridin-1-yloxyethyl)silane.
| Compound Name | trimethyl(2-pyrrolo[2,3-b]pyridin-1-yloxyethyl)silane |
|---|---|
| PubChem CID | 153406221 |
| Molecular Formula | C12H18N2OSi |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | trimethyl(2-pyrrolo[2,3-b]pyridin-1-yloxyethyl)silane |
| SMILES | C[Si](C)(C)CCOn1ccc2cccnc21 |
| InChI | InChI=1S/C12H18N2OSi/c1-16(2,3)10-9-15-14-8-6-11-5-4-7-13-12(11)14/h4-8H,9-10H2,1-3H3 |
| InChIKey | HOBHVPNBBADHIJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|