C14H13N3O — CID 141009277
1-ethoxy-2-pyridin-4-ylpyrrolo[2,3-b]pyridine (PubChem CID 141009277) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 1-ethoxy-2-pyridin-4-ylpyrrolo[2,3-b]pyridine.
| Compound Name | 1-ethoxy-2-pyridin-4-ylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 141009277 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-ethoxy-2-pyridin-4-ylpyrrolo[2,3-b]pyridine |
| SMILES | CCOn1c(-c2ccncc2)cc2cccnc21 |
| InChI | InChI=1S/C14H13N3O/c1-2-18-17-13(11-5-8-15-9-6-11)10-12-4-3-7-16-14(12)17/h3-10H,2H2,1H3 |
| InChIKey | WMBIRDZOIWBXKZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |