About 1-pyridin-3-yloxy-1,8-naphthyridin-2-one
1-pyridin-3-yloxy-1,8-naphthyridin-2-one (PubChem CID 130302527) has the molecular formula C13H9N3O2
and a molecular weight of 239.23 g/mol. Its IUPAC name is 1-pyridin-3-yloxy-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 1-pyridin-3-yloxy-1,8-naphthyridin-2-one |
| PubChem CID | 130302527 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 1-pyridin-3-yloxy-1,8-naphthyridin-2-one |
| SMILES | O=c1ccc2cccnc2n1Oc1cccnc1 |
| InChI | InChI=1S/C13H9N3O2/c17-12-6-5-10-3-1-8-15-13(10)16(12)18-11-4-2-7-14-9-11/h1-9H |
| InChIKey | XFWYNQHHKKRPAU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-pyridin-3-yloxy-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-3-yloxy-1,8-naphthyridin-2-one?
The IUPAC name of 1-pyridin-3-yloxy-1,8-naphthyridin-2-one (CID 130302527) is 1-pyridin-3-yloxy-1,8-naphthyridin-2-one.
What is the SMILES notation for 1-pyridin-3-yloxy-1,8-naphthyridin-2-one?
The canonical SMILES for 1-pyridin-3-yloxy-1,8-naphthyridin-2-one is O=c1ccc2cccnc2n1Oc1cccnc1.
What is the InChIKey of 1-pyridin-3-yloxy-1,8-naphthyridin-2-one?
The InChIKey is XFWYNQHHKKRPAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O2/c17-12-6-5-10-3-1-8-15-13(10)16(12)18-11-4-2-7-14-9-11/h1-9H.
What are the key properties of 1-pyridin-3-yloxy-1,8-naphthyridin-2-one?
1-pyridin-3-yloxy-1,8-naphthyridin-2-one has a molecular weight of 239.23 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-3-yloxy-1,8-naphthyridin-2-one is sourced from PubChem (CID 130302527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).