C10H10N2O2 — CID 175990314
1-ethoxy-1,6-naphthyridin-2-one (PubChem CID 175990314) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 1-ethoxy-1,6-naphthyridin-2-one.
| Compound Name | 1-ethoxy-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 175990314 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1-ethoxy-1,6-naphthyridin-2-one |
| SMILES | CCOn1c(=O)ccc2cnccc21 |
| InChI | InChI=1S/C10H10N2O2/c1-2-14-12-9-5-6-11-7-8(9)3-4-10(12)13/h3-7H,2H2,1H3 |
| InChIKey | DKONJWCDOZORJA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |