C9H9N3O — CID 121470936
1-(methylamino)-1,6-naphthyridin-2-one (PubChem CID 121470936) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-(methylamino)-1,6-naphthyridin-2-one.
| Compound Name | 1-(methylamino)-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 121470936 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 1-(methylamino)-1,6-naphthyridin-2-one |
| SMILES | CNn1c(=O)ccc2cnccc21 |
| InChI | InChI=1S/C9H9N3O/c1-10-12-8-4-5-11-6-7(8)2-3-9(12)13/h2-6,10H,1H3 |
| InChIKey | NBPUJAMPKGGWJH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |